Information card for entry 2212130
| Common name |
3-Benzyl-4,5,6,7-tetrachloro-3-hydroxy-2-(3-hydroxypropyl)isoindolin-1-one |
| Chemical name |
3-Benzyl-4,5,6,7-tetrachloro-3-hydroxy-2-(3-hydroxypropyl)isoindolin-1-one |
| Formula |
C18 H15 Cl4 N O3 |
| Calculated formula |
C18 H15 Cl4 N O3 |
| SMILES |
Clc1c2C(=O)N(C(O)(c2c(Cl)c(Cl)c1Cl)Cc1ccccc1)CCCO |
| Title of publication |
3-Benzyl-4,5,6,7-tetrachloro-3-hydroxy-2-(3-hydroxypropyl)isoindolin-1-one |
| Authors of publication |
Hoong-Kun Fun; Yong-Miao Shen; Jian-Hua Xu; Suchada Chantrapromma |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
2 |
| Pages of publication |
o944 - o945 |
| a |
10.8345 ± 0.0002 Å |
| b |
9.9173 ± 0.0002 Å |
| c |
18.7629 ± 0.0003 Å |
| α |
90° |
| β |
113.983 ± 0.001° |
| γ |
90° |
| Cell volume |
1842 ± 0.06 Å3 |
| Cell temperature |
100 ± 0.1 K |
| Ambient diffraction temperature |
297 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0387 |
| Residual factor for significantly intense reflections |
0.032 |
| Weighted residual factors for significantly intense reflections |
0.0786 |
| Weighted residual factors for all reflections included in the refinement |
0.0837 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.06 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2212130.html