Information card for entry 2212132
| Chemical name |
2-{(2-Chlorophenyl)[(2,4-dichlorophenoxy)acetoxy]methyl]-5,5-dimethyl- 1,3,2-dioxaphosphinan-2-one |
| Formula |
C20 H20 Cl3 O6 P |
| Calculated formula |
C20 H20 Cl3 O6 P |
| SMILES |
C1(COP(=O)(C(c2ccccc2Cl)OC(=O)COc2c(cc(cc2)Cl)Cl)OC1)(C)C |
| Title of publication |
2-{(2-Chlorophenyl)[(2,4-dichlorophenoxy)acetoxy]methyl}-5,5-dimethyl-1,3,2-dioxaphosphinan-2-one |
| Authors of publication |
Zuo, Na; He, Hong-Wu |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
2 |
| Pages of publication |
o794 - o795 |
| a |
8.8627 ± 0.0007 Å |
| b |
10.4972 ± 0.0009 Å |
| c |
13.3624 ± 0.0011 Å |
| α |
79.834 ± 0.001° |
| β |
83.707 ± 0.001° |
| γ |
69.936 ± 0.001° |
| Cell volume |
1147.75 ± 0.16 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0578 |
| Residual factor for significantly intense reflections |
0.0509 |
| Weighted residual factors for significantly intense reflections |
0.1337 |
| Weighted residual factors for all reflections included in the refinement |
0.1398 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.045 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2212132.html