Information card for entry 2212161
| Chemical name |
5-Benzyl-1,3,5-trimethylpyrimidine-2,4,6(1H,3H,5H)-trithione |
| Formula |
C14 H16 N2 S3 |
| Calculated formula |
C14 H16 N2 S3 |
| SMILES |
S=C1N(C(=S)C(C(=S)N1C)(C)Cc1ccccc1)C |
| Title of publication |
5-Benzyl-1,3,5-trimethylpyrimidine-2,4,6(1<i>H</i>,3<i>H</i>,5<i>H</i>)-trithione |
| Authors of publication |
Takechi, Haruko; Kubo, Kanji; Takahashi, Hajime; Matsumoto, Taisuke |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
2 |
| Pages of publication |
o701 - o703 |
| a |
13.112 ± 0.013 Å |
| b |
8.35 ± 0.008 Å |
| c |
13.299 ± 0.013 Å |
| α |
90° |
| β |
90.721 ± 0.007° |
| γ |
90° |
| Cell volume |
1456 ± 2 Å3 |
| Cell temperature |
123.1 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/a 1 |
| Hall space group symbol |
-P 2yab |
| Residual factor for significantly intense reflections |
0.0279 |
| Weighted residual factors for all reflections included in the refinement |
0.0892 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.055 |
| Diffraction radiation wavelength |
0.7107 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2212161.html