Information card for entry 2212243
| Chemical name |
2,2'-(9,10-Dioxo-9,10-dihydroanthracene-1,8-diyldioxy)bis(N,N-diethylacetamide) |
| Formula |
C26 H30 N2 O6 |
| Calculated formula |
C26 H30 N2 O6 |
| SMILES |
O=C(N(CC)CC)COc1cccc2C(=O)c3cccc(OCC(=O)N(CC)CC)c3C(=O)c12 |
| Title of publication |
2,2'-(9,10-Dioxo-9,10-dihydroanthracene-1,8-diyldioxy)bis(<i>N</i>,<i>N</i>-diethylacetamide) |
| Authors of publication |
Shao-Jin Gu; Lin-Hai Jing; Huan-Xia Zhang; Da-Bin Qin |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
2 |
| Pages of publication |
o563 - o564 |
| a |
10.313 ± 0.004 Å |
| b |
11.462 ± 0.004 Å |
| c |
11.668 ± 0.004 Å |
| α |
82.418 ± 0.007° |
| β |
74.33 ± 0.007° |
| γ |
64.749 ± 0.007° |
| Cell volume |
1200.9 ± 0.8 Å3 |
| Cell temperature |
294 ± 2 K |
| Ambient diffraction temperature |
294 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1133 |
| Residual factor for significantly intense reflections |
0.0482 |
| Weighted residual factors for significantly intense reflections |
0.1161 |
| Weighted residual factors for all reflections included in the refinement |
0.1498 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.004 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2212243.html
