Information card for entry 2212292
| Chemical name |
1-(3,3,5-trimethyl-2-phenyl-1,2-oxazolidin-5-yl)-1H-indol-3(2H)-one |
| Formula |
C20 H22 N2 O2 |
| Calculated formula |
C20 H22 N2 O2 |
| SMILES |
O1N(C(CC1(N1C(=O)Cc2ccccc12)C)(C)C)c1ccccc1 |
| Title of publication |
An unexpected <i>N</i>-substituted oxindole: 1-(3,3,5-trimethyl-2-phenyl-1,2-oxazolidin-5-yl)-1<i>H</i>-indol-3(2<i>H</i>)-one |
| Authors of publication |
Parvez, Masood; Mehrdad, Morteza; Sureni, Hossein; Heydari, Akbar; Jadidi, Khosrow |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
2 |
| Pages of publication |
o877 - o878 |
| a |
10.321 ± 0.003 Å |
| b |
14.446 ± 0.004 Å |
| c |
11.378 ± 0.004 Å |
| α |
90° |
| β |
98.554 ± 0.012° |
| γ |
90° |
| Cell volume |
1677.6 ± 0.9 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.075 |
| Residual factor for significantly intense reflections |
0.042 |
| Weighted residual factors for significantly intense reflections |
0.094 |
| Weighted residual factors for all reflections included in the refinement |
0.108 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.02 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2212292.html