Information card for entry 2212316
| Chemical name |
(2,6-Diphenylphenolato-κO)bis(2-methylquinolin-8-olato-κ^2^N,O)gallium(III) |
| Formula |
C38 H29 Ga N2 O3 |
| Calculated formula |
C38 H29 Ga N2 O3 |
| SMILES |
[Ga]12(Oc3c4[n]1c(C)ccc4ccc3)(Oc1c3[n]2c(C)ccc3ccc1)Oc1c(c2ccccc2)cccc1c1ccccc1 |
| Title of publication |
(2,6-Diphenylphenolato-κ<i>O</i>)bis(2-methylquinolin-8-olato-κ^2^<i>N</i>,<i>O</i>)gallium(III) |
| Authors of publication |
Rajeswaran, Manju; Place, David W.; Deaton, Joseph C.; Brown, Christopher T.; Lenhart, William C. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
2 |
| Pages of publication |
m550 - m552 |
| a |
15.409 ± 0.0002 Å |
| b |
13.097 ± 0.0002 Å |
| c |
15.715 ± 0.0002 Å |
| α |
90° |
| β |
107.783 ± 0.0007° |
| γ |
90° |
| Cell volume |
3019.94 ± 0.07 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0519 |
| Residual factor for significantly intense reflections |
0.0352 |
| Weighted residual factors for significantly intense reflections |
0.0884 |
| Weighted residual factors for all reflections included in the refinement |
0.0962 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.027 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2212316.html