Information card for entry 2212324
| Chemical name |
1,3,5-Trichloro-2,4,6-tripyrrol-1-ylbenzene |
| Formula |
C18 H12 Cl3 N3 |
| Calculated formula |
C18 H12 Cl3 N3 |
| SMILES |
Clc1c(n2cccc2)c(Cl)c(n2cccc2)c(Cl)c1n1cccc1 |
| Title of publication |
1,3,5-Trichloro-2,4,6-tripyrrol-1-ylbenzene |
| Authors of publication |
Zhang, Tao; Davila, Alfonso; McLaughlin, Mark L.; Watkins, Steven F.; Fronczek, Frank R. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
2 |
| Pages of publication |
o604 - o605 |
| a |
11.167 ± 0.003 Å |
| b |
11.534 ± 0.003 Å |
| c |
15.799 ± 0.003 Å |
| α |
86.02 ± 0.02° |
| β |
69.58 ± 0.02° |
| γ |
65.19 ± 0.02° |
| Cell volume |
1723.9 ± 0.8 Å3 |
| Cell temperature |
100 K |
| Ambient diffraction temperature |
100 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.057 |
| Residual factor for significantly intense reflections |
0.038 |
| Weighted residual factors for significantly intense reflections |
0.091 |
| Weighted residual factors for all reflections included in the refinement |
0.099 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.036 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2212324.html