Information card for entry 2212337
| Chemical name |
(S)-(-)-2,2'-Bis(2-methylallyloxy)-1,1'-binaphthyl |
| Formula |
C28 H26 O2 |
| Calculated formula |
C28 H26 O2 |
| SMILES |
CC(=C)COc1ccc2c(c1c1c(OCC(=C)C)ccc3c1cccc3)cccc2 |
| Title of publication |
(<i>S</i>)-(–)-2,2'-Bis(2-methylallyloxy)-1,1'-binaphthyl |
| Authors of publication |
Ricken, Stefan; Angelovski, Goran; Schürmann, Markus; Preut, Hans; Eilbracht, Peter |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
2 |
| Pages of publication |
o551 - o552 |
| a |
11.5777 ± 0.0008 Å |
| b |
11.5777 ± 0.0008 Å |
| c |
16.2234 ± 0.0008 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2174.6 ± 0.2 Å3 |
| Cell temperature |
291 ± 1 K |
| Ambient diffraction temperature |
291 ± 1 K |
| Number of distinct elements |
3 |
| Space group number |
80 |
| Hermann-Mauguin space group symbol |
I 41 |
| Hall space group symbol |
I 4bw |
| Residual factor for all reflections |
0.0677 |
| Residual factor for significantly intense reflections |
0.0273 |
| Weighted residual factors for significantly intense reflections |
0.0536 |
| Weighted residual factors for all reflections included in the refinement |
0.0571 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.876 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2212337.html