Information card for entry 2212363
| Chemical name |
Diaqua(pyridine-2,4,6-tricarboxylato-κ^3^N,O^2^,O^6^)[4-(4- pyridyl)pyridinium-κN^1^]cobalt(II) dihydrate |
| Formula |
C18 H19 Co N3 O10 |
| Calculated formula |
C18 H19 Co N3 O10 |
| SMILES |
[Co]12([OH2])([OH2])(OC(=O)c3[n]2c(cc(c3)C(=O)[O-])C(=O)O1)[n]1ccc(cc1)c1cc[nH+]cc1.O.O |
| Title of publication |
Diaqua(pyridine-2,4,6-tricarboxylato-κ^3^<i>N</i>,<i>O</i>^2^,<i>O</i>^6^)[4-(4-pyridyl)pyridinium-κ<i>N</i>^1^]cobalt(II) dihydrate |
| Authors of publication |
Xie, Cheng-Zhi; Qin, Jian-Hua; Wang, Jian-Ge; Li, Chang-Bin; Li, Yong-Feng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
2 |
| Pages of publication |
m498 - m500 |
| a |
8.6711 ± 0.0009 Å |
| b |
10.7727 ± 0.0012 Å |
| c |
11.5702 ± 0.0013 Å |
| α |
95.804 ± 0.001° |
| β |
96.604 ± 0.001° |
| γ |
110.547 ± 0.001° |
| Cell volume |
993.62 ± 0.19 Å3 |
| Cell temperature |
291 ± 2 K |
| Ambient diffraction temperature |
291 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0329 |
| Residual factor for significantly intense reflections |
0.0282 |
| Weighted residual factors for significantly intense reflections |
0.0731 |
| Weighted residual factors for all reflections included in the refinement |
0.0763 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.046 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2212363.html