Information card for entry 2212387
| Common name |
3,9-dibromo-2,8-dimethyl Tröger's base |
| Chemical name |
3,9-dibromo-2,8-dimethyl-6H,12H-5,11-methanodibenzo[b,f][1,5]diazocine |
| Formula |
C17 H16 Br2 N2 |
| Calculated formula |
C17 H16 Br2 N2 |
| SMILES |
Brc1cc2N3CN(Cc2cc1C)c1cc(Br)c(cc1C3)C |
| Title of publication |
3,9-Dibromo-2,8-dimethyl-6<i>H</i>,12<i>H</i>-5,11-methanodibenzo[<i>b</i>,<i>f</i>][1,5]diazocine |
| Authors of publication |
Faroughi, Masoud; Scudder, Marcia; Turner, Peter; Jensen, Paul; Try, Andrew C. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
2 |
| Pages of publication |
o1048 - o1050 |
| a |
6.891 ± 0.0001 Å |
| b |
10.0369 ± 0.0002 Å |
| c |
12.0624 ± 0.0002 Å |
| α |
99.826 ± 0.001° |
| β |
95.971 ± 0.001° |
| γ |
107.817 ± 0.001° |
| Cell volume |
771.69 ± 0.02 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.088 |
| Residual factor for significantly intense reflections |
0.036 |
| Weighted residual factors for significantly intense reflections |
0.072 |
| Weighted residual factors for all reflections included in the refinement |
0.085 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.02 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2212387.html