Information card for entry 2212424
| Chemical name |
(S,S)-6,6'-Dimethyl-2,2'-[o-phenylenebis(nitrilomethylidyne)]diphenol benzene solvate |
| Formula |
C28 H32 N2 O2 |
| Calculated formula |
C28 H32 N2 O2 |
| SMILES |
[C@@H]1(CCCC[C@@H]1/N=C/c1cccc(c1O)C)/N=C/c1cccc(c1O)C.c1ccccc1 |
| Title of publication |
(<i>S</i>,<i>S</i>)-6,6'-Dimethyl-2,2'-[<i>o</i>-phenylenebis(nitrilomethylidyne)]diphenol benzene solvate |
| Authors of publication |
Yang, Ming-Hua; Yan, Guo-Bing; Zheng, Fun-Fa |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
2 |
| Pages of publication |
o824 - o826 |
| a |
8.276 ± 0.0018 Å |
| b |
26.636 ± 0.006 Å |
| c |
12.25 ± 0.003 Å |
| α |
90° |
| β |
105.25 ± 0.003° |
| γ |
90° |
| Cell volume |
2605.3 ± 1 Å3 |
| Cell temperature |
291 ± 2 K |
| Ambient diffraction temperature |
291 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.078 |
| Residual factor for significantly intense reflections |
0.057 |
| Weighted residual factors for significantly intense reflections |
0.144 |
| Weighted residual factors for all reflections included in the refinement |
0.151 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.06 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2212424.html