Information card for entry 2212456
| Chemical name |
(E,E)-N,N'-bis(4-methoxybenzylidene)hexane-1,6-diamine |
| Formula |
C22 H28 N2 O2 |
| Calculated formula |
C22 H28 N2 O2 |
| SMILES |
c1(ccc(OC)cc1)/C=N/CCCCCC/N=C/c1ccc(OC)cc1 |
| Title of publication |
(<i>E</i>,<i>E</i>)-<i>N</i>,<i>N</i>'-Bis(4-methoxybenzylidene)hexane-1,6-diamine |
| Authors of publication |
Li, Jian; Liang, Zu-Pei; Wu, Qian |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
3 |
| Pages of publication |
o1086 - o1087 |
| a |
8.018 ± 0.004 Å |
| b |
8.34 ± 0.004 Å |
| c |
15.486 ± 0.008 Å |
| α |
90° |
| β |
96.831 ± 0.009° |
| γ |
90° |
| Cell volume |
1028.2 ± 0.9 Å3 |
| Cell temperature |
294 ± 2 K |
| Ambient diffraction temperature |
294 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.078 |
| Residual factor for significantly intense reflections |
0.0394 |
| Weighted residual factors for significantly intense reflections |
0.0904 |
| Weighted residual factors for all reflections included in the refinement |
0.1093 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.033 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2212456.html