Information card for entry 2212499
| Chemical name |
(3aR,4R,4aS,9aR)-4-Hydroxyperhydrofuro[2,3-f]indolizin-7(2H)-one |
| Formula |
C10 H15 N O3 |
| Calculated formula |
C10 H15 N O3 |
| SMILES |
N12C(=O)CC[C@H]1[C@@H]([C@@H]1[C@H](C2)OCC1)O |
| Title of publication |
(3a<i>R</i>,4<i>R</i>,4a<i>S</i>,9a<i>R</i>)-4-Hydroxyperhydrofuro[2,3-<i>f</i>]indolizin-7(2<i>H</i>)-one |
| Authors of publication |
Švorc, Ľubomír; Vrábel, Viktor; Kožíšek, Jozef; Marchalín, Štefan; Žúžiová, Jozefína |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
3 |
| Pages of publication |
o1452 - o1454 |
| a |
8.3423 ± 0.0002 Å |
| b |
8.6807 ± 0.0002 Å |
| c |
13.7985 ± 0.0003 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
999.25 ± 0.04 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0691 |
| Residual factor for significantly intense reflections |
0.0392 |
| Weighted residual factors for significantly intense reflections |
0.0855 |
| Weighted residual factors for all reflections included in the refinement |
0.0912 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.003 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2212499.html