Information card for entry 2212671
| Chemical name |
2-(2,4-Dichloro-6-methylphenoxy)-3-isopropyl-5,6,7,8- tetrahydrobenzothieno[2,3-d]pyrimidin-4(3H)-one |
| Formula |
C20 H20 Cl2 N2 O2 S |
| Calculated formula |
C20 H20 Cl2 N2 O2 S |
| SMILES |
Clc1cc(C)c(c(c1)Cl)Oc1nc2sc3c(c2c(=O)n1C(C)C)CCCC3 |
| Title of publication |
2-(2,4-Dichloro-6-methylphenoxy)-3-isopropyl-5,6,7,8-tetrahydrobenzothieno[2,3-<i>d</i>]pyrimidin-4(3<i>H</i>)-one |
| Authors of publication |
Zheng, Ai-Hua; Long, Ji-Yin; Zeng, Xiao-Hua; Wang, Hong-Mei |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
3 |
| Pages of publication |
o1142 - o1144 |
| a |
8.3028 ± 0.0008 Å |
| b |
18.0664 ± 0.0017 Å |
| c |
13.7999 ± 0.0013 Å |
| α |
90° |
| β |
100.954 ± 0.002° |
| γ |
90° |
| Cell volume |
2032.3 ± 0.3 Å3 |
| Cell temperature |
292 ± 2 K |
| Ambient diffraction temperature |
292 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.061 |
| Residual factor for significantly intense reflections |
0.0465 |
| Weighted residual factors for significantly intense reflections |
0.1316 |
| Weighted residual factors for all reflections included in the refinement |
0.1393 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.037 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2212671.html