Information card for entry 2212684
| Chemical name |
2-(4-Methylbenzoyloxymethyl)-5-(5-methyl-2,4-dioxo-1,2,3,4- tetrahydropyrimidin-1-yl)tetrahydrofuran-3-yl 4-methylbenzoate |
| Formula |
C26 H26 N2 O7 |
| Calculated formula |
C26 H26 N2 O7 |
| SMILES |
O1[C@@H](C[C@H]([C@@H]1COC(=O)c1ccc(cc1)C)OC(=O)c1ccc(cc1)C)N1C(=O)NC(=O)C(=C1)C |
| Title of publication |
2-(4-Methylbenzoyloxymethyl)-5-(5-methyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidin-1-yl)tetrahydrofuran-3-yl 4-methylbenzoate |
| Authors of publication |
Yathirajan, H. S.; Mayekar, Anil N.; Sarojini, B. K.; Narayana, B.; Bolte, Michael |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
3 |
| Pages of publication |
o1395 - o1397 |
| a |
6.4353 ± 0.0004 Å |
| b |
10.6994 ± 0.0007 Å |
| c |
34.373 ± 0.002 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2366.7 ± 0.3 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0447 |
| Residual factor for significantly intense reflections |
0.0407 |
| Weighted residual factors for significantly intense reflections |
0.1065 |
| Weighted residual factors for all reflections included in the refinement |
0.1091 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.01 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2212684.html