Information card for entry 2212762
| Chemical name |
1,1'-[4-(5-bromo-2-furyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-diyl]diethanone |
| Formula |
C15 H16 Br N O3 |
| Calculated formula |
C15 H16 Br N O3 |
| SMILES |
C1(=C(C(C(=C(C)N1)C(=O)C)c1ccc(o1)Br)C(=O)C)C |
| Title of publication |
1,1'-[4-(5-Bromo-2-furyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-diyl]diethanone |
| Authors of publication |
Švorc, Ľubomír; Vrábel, Viktor; Kožíšek, Jozef; Marchalín, Štefan; Šafář Peter |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
4 |
| Pages of publication |
o1590 - o1592 |
| a |
8.191 ± 0.0001 Å |
| b |
15.1488 ± 0.0002 Å |
| c |
12.5623 ± 0.0002 Å |
| α |
90° |
| β |
107.885 ± 0.002° |
| γ |
90° |
| Cell volume |
1483.45 ± 0.04 Å3 |
| Cell temperature |
295 K |
| Ambient diffraction temperature |
295 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0608 |
| Residual factor for significantly intense reflections |
0.0308 |
| Weighted residual factors for significantly intense reflections |
0.0811 |
| Weighted residual factors for all reflections included in the refinement |
0.1113 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.034 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2212762.html