Information card for entry 2212800
| Chemical name |
{4-Allyloxy-2,6-bis[(dimethylamino)methyl]phenyl- κ^3^C^1^,N,N'}iodopalladium(II) |
| Formula |
C15 H23 I N2 O Pd |
| Calculated formula |
C15 H23 I N2 O Pd |
| SMILES |
I[Pd]12[N](Cc3c2c(cc(OCC=C)c3)C[N]1(C)C)(C)C |
| Title of publication |
{4-Allyloxy-2,6-bis[(dimethylamino)methyl]phenyl-κ^3^<i>C</i>^1^,<i>N</i>,<i>N</i>'}iodidopalladium(II) |
| Authors of publication |
Chrzanowski, Lars S. von; Lutz, Martin; Spek, Anthony L.; Dijkstra, Harm P.; Koten, Gerard von |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
4 |
| Pages of publication |
m1096 - m1098 |
| a |
8.9404 ± 0.0001 Å |
| b |
12.7563 ± 0.0001 Å |
| c |
15.0229 ± 0.0002 Å |
| α |
90° |
| β |
90.9663 ± 0.0007° |
| γ |
90° |
| Cell volume |
1713.06 ± 0.03 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0212 |
| Residual factor for significantly intense reflections |
0.0182 |
| Weighted residual factors for significantly intense reflections |
0.0402 |
| Weighted residual factors for all reflections included in the refinement |
0.0412 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.053 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2212800.html