Information card for entry 2212891
| Chemical name |
N-(2,6-Dimethylphenyl)-2-(2-{3-[4-(methylsulfanyl)phenyl]-1,2,4-oxadiazol- 5-yl}phenoxy)acetamide |
| Formula |
C25 H23 N3 O3 S |
| Calculated formula |
C25 H23 N3 O3 S |
| SMILES |
S(C)c1ccc(cc1)c1noc(n1)c1c(OCC(=O)Nc2c(C)cccc2C)cccc1 |
| Title of publication |
<i>N</i>-(2,6-Dimethylphenyl)-2-(2-{3-[4-(methylsulfanyl)phenyl]-1,2,4-oxadiazol-5-yl}phenoxy)acetamide |
| Authors of publication |
Yin, Jun; Xing, Zhi-Tao; Wang, Hai-Bo; Ding, Wei-Lin; Wang, Pin-Liang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
4 |
| Pages of publication |
o1683 - o1684 |
| a |
8.616 ± 0.0017 Å |
| b |
9.29 ± 0.0019 Å |
| c |
15.225 ± 0.003 Å |
| α |
84.34 ± 0.03° |
| β |
81.45 ± 0.03° |
| γ |
66.66 ± 0.03° |
| Cell volume |
1105.4 ± 0.5 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1051 |
| Residual factor for significantly intense reflections |
0.0535 |
| Weighted residual factors for significantly intense reflections |
0.1153 |
| Weighted residual factors for all reflections included in the refinement |
0.1329 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.012 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2212891.html