Information card for entry 2212929
| Chemical name |
6,9-Dichloro-1,2,3,4-tetrahydroacridine |
| Formula |
C13 H11 Cl2 N |
| Calculated formula |
C13 H11 Cl2 N |
| SMILES |
C1CCCc2nc3cc(Cl)ccc3c(Cl)c12 |
| Title of publication |
6,9-Dichloro-1,2,3,4-tetrahydroacridine |
| Authors of publication |
Elsinghorst, Paul Wilhelm; Nieger, Martin; Gütschow, Michael |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
4 |
| Pages of publication |
o1818 - o1820 |
| a |
8.405 ± 0.0006 Å |
| b |
9.0451 ± 0.0007 Å |
| c |
9.0962 ± 0.0009 Å |
| α |
108.603 ± 0.005° |
| β |
95.617 ± 0.005° |
| γ |
116.885 ± 0.003° |
| Cell volume |
560.07 ± 0.09 Å3 |
| Cell temperature |
123 ± 2 K |
| Ambient diffraction temperature |
123 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0481 |
| Residual factor for significantly intense reflections |
0.0321 |
| Weighted residual factors for significantly intense reflections |
0.0747 |
| Weighted residual factors for all reflections included in the refinement |
0.0794 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.98 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2212929.html
