Information card for entry 2212932
| Chemical name |
Bis[μ-4,4'-methylenebis(3-hydroxy-2-naphthoato- κ^2^O:O')]bis[aqua(ethylenediamine-κ^2^N,N')copper(II)] |
| Formula |
C50 H48 Cu2 N4 O14 |
| Calculated formula |
C50 H48 Cu2 N4 O14 |
| SMILES |
[NH2]1CC[NH2][Cu]21([OH2])OC(=O)c1cc3ccccc3c(c1O)Cc1c3c(cc(C(=O)O[Cu]4([NH2]CC[NH2]4)(OC(=O)c4cc5ccccc5c(c4O)Cc4c5c(cc(C(=O)O2)c4O)cccc5)[OH2])c1O)cccc3 |
| Title of publication |
Bis[μ-4,4'-methylenebis(3-hydroxy-2-naphthoato-κ^2^<i>O</i>:<i>O</i>')]bis[aqua(ethylenediamine-κ^2^<i>N</i>,<i>N</i>')copper(II)] |
| Authors of publication |
Yin, Wei-Rong; Ye, Jun-Wei; Ye, Ling; Zhang, Ping; Xu, Jia-Ning |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
4 |
| Pages of publication |
m1165 - m1167 |
| a |
12.379 ± 0.003 Å |
| b |
21.425 ± 0.004 Å |
| c |
8.842 ± 0.0018 Å |
| α |
90° |
| β |
107.45 ± 0.03° |
| γ |
90° |
| Cell volume |
2237.2 ± 0.9 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0727 |
| Residual factor for significantly intense reflections |
0.0433 |
| Weighted residual factors for significantly intense reflections |
0.1285 |
| Weighted residual factors for all reflections included in the refinement |
0.1504 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.983 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2212932.html