Information card for entry 2212997
| Chemical name |
2,4-Bis(4-methoxyphenyl)-3-phenyl-1,3,2,4-thiazadiphosphetidine 2,4-disulfide |
| Formula |
C20 H19 N O2 P2 S3 |
| Calculated formula |
C20 H19 N O2 P2 S3 |
| SMILES |
N1(P(=S)(SP1(=S)c1ccc(OC)cc1)c1ccc(OC)cc1)c1ccccc1 |
| Title of publication |
2,4-Bis(4-methoxyphenyl)-3-phenyl-1,3,2,4-thiazadiphosphetidine 2,4-disulfide |
| Authors of publication |
Rothenberger, Alexander; Shi, Weifeng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
4 |
| Pages of publication |
o1798 - o1799 |
| a |
10.406 ± 0.002 Å |
| b |
15.8954 ± 0.0017 Å |
| c |
13.0056 ± 0.0018 Å |
| α |
90° |
| β |
97.326 ± 0.013° |
| γ |
90° |
| Cell volume |
2133.7 ± 0.6 Å3 |
| Cell temperature |
120 ± 2 K |
| Ambient diffraction temperature |
120 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1172 |
| Residual factor for significantly intense reflections |
0.0547 |
| Weighted residual factors for significantly intense reflections |
0.1341 |
| Weighted residual factors for all reflections included in the refinement |
0.1728 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.902 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2212997.html