Information card for entry 2213000
| Chemical name |
2,2'-[1,1'-(Propane-1,3-diyl)bis(nitriloethylidyne)diphenol |
| Formula |
C19 H22 N2 O2 |
| Calculated formula |
C19 H22 N2 O2 |
| SMILES |
c1(ccccc1C(=N/CCC/N=C(C)/c1ccccc1O)/C)O |
| Title of publication |
2,2'-[1,1'-(Propane-1,3-diyl)bis(nitriloethylidyne)]diphenol |
| Authors of publication |
Selvakumar, J.; Babu Varghese; Raghunathan, V. S.; Nagaraja, K. S. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
4 |
| Pages of publication |
o1924 - o1925 |
| a |
12.4524 ± 0.0004 Å |
| b |
15.3347 ± 0.0005 Å |
| c |
8.8832 ± 0.0002 Å |
| α |
90° |
| β |
96.991 ± 0.002° |
| γ |
90° |
| Cell volume |
1683.67 ± 0.09 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
294 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.082 |
| Residual factor for significantly intense reflections |
0.0523 |
| Weighted residual factors for significantly intense reflections |
0.1565 |
| Weighted residual factors for all reflections included in the refinement |
0.1932 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.017 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2213000.html