Information card for entry 2213007
| Common name |
cyclotricatechylene.(acetone)~2~ |
| Chemical name |
2,3,7,8,12,13-Hexahydroxy-10,15-dihydro-5H-tribenzo[a,d,g]cyclononene acetone disolvate |
| Formula |
C27 H30 O8 |
| Calculated formula |
C27 H30 O8 |
| SMILES |
c12cc(c(cc1Cc1cc(c(cc1Cc1cc(c(cc1C2)O)O)O)O)O)O.CC(=O)C.CC(=O)C |
| Title of publication |
2,3,7,8,12,13-Hexahydroxy-10,15-dihydro-5<i>H</i>-tribenzo[<i>a</i>,<i>d</i>,<i>g</i>]cyclononene acetone disolvate |
| Authors of publication |
Christopher J. Sumby; Michaele J. Hardie |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
4 |
| Pages of publication |
o1537 - o1539 |
| a |
10.668 ± 0.0002 Å |
| b |
11.0804 ± 0.0003 Å |
| c |
11.0992 ± 0.0003 Å |
| α |
79.924 ± 0.001° |
| β |
65.001 ± 0.001° |
| γ |
82.157 ± 0.002° |
| Cell volume |
1167.86 ± 0.05 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1312 |
| Residual factor for significantly intense reflections |
0.0541 |
| Weighted residual factors for significantly intense reflections |
0.1235 |
| Weighted residual factors for all reflections included in the refinement |
0.1539 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.964 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2213007.html