Information card for entry 2213084
| Chemical name |
7-Allyl-1,3-dimethyl-2,4-dioxo-2,3,4,7-tetrahydro- 1<i>H</i>-pyrrolo[2,3-<i>d</i>]pyrimidine-6-carbaldehyde |
| Formula |
C12 H13 N3 O3 |
| Calculated formula |
C12 H13 N3 O3 |
| SMILES |
c12c(C(=O)N(C(=O)N1C)C)cc(C=O)n2CC=C |
| Title of publication |
7-Allyl-1,3-dimethyl-2,4-dioxo-2,3,4,7-tetrahydro-1<i>H</i>-pyrrolo[2,3-<i>d</i>]pyrimidine-6-carbaldehyde |
| Authors of publication |
B. K. Satis Kumar; D. Gayathri; D. Velmurugan; K. Ravikumar; E. Ramesh |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
5 |
| Pages of publication |
o2303 - o2305 |
| a |
6.7065 ± 0.0004 Å |
| b |
13.1295 ± 0.0009 Å |
| c |
13.6977 ± 0.0009 Å |
| α |
90° |
| β |
99.613 ± 0.001° |
| γ |
90° |
| Cell volume |
1189.19 ± 0.13 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0503 |
| Residual factor for significantly intense reflections |
0.0461 |
| Weighted residual factors for significantly intense reflections |
0.1343 |
| Weighted residual factors for all reflections included in the refinement |
0.1394 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.03 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2213084.html