Information card for entry 2213145
| Chemical name |
Bis[μ-4,5-dicyano-N,N'-bis(p-tolylsulfonyl)-o- phenylendiaminato]bis[diamminecopper(II)] dihydrate |
| Formula |
C22 H24 Cu N6 O5 S2 |
| Calculated formula |
C22 H24 Cu N6 O5 S2 |
| SMILES |
c1(ccc(cc1)C)S(=O)(=O)N1c2cc(c(cc2N([Cu]1([NH3])[NH3])S(=O)(=O)c1ccc(cc1)C)C#N)C#N.O |
| Title of publication |
Bis[μ-4,5-dicyano-<i>N</i>,<i>N</i>'-bis(<i>p</i>-tolylsulfonyl)-<i>o</i>-phenylenediaminato]bis[diamminecopper(II)] dihydrate |
| Authors of publication |
Yuksel, Fatma; Tuncel, Sinem; Gurek, Ayse Gul; Jeanneau, Erwann; Luneau, Dominique; Ahsen, Vefa |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
5 |
| Pages of publication |
m1380 - m1382 |
| a |
14.1946 ± 0.0008 Å |
| b |
10.1475 ± 0.0007 Å |
| c |
19.267 ± 0.001 Å |
| α |
90° |
| β |
118.117 ± 0.003° |
| γ |
90° |
| Cell volume |
2447.7 ± 0.3 Å3 |
| Cell temperature |
293 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for significantly intense reflections |
0.0558 |
| Weighted residual factors for all reflections included in the refinement |
0.0593 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.0528 |
| Diffraction radiation wavelength |
0.71069 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2213145.html