Information card for entry 2213320
| Chemical name |
3-[4,5-Bis(2-cyanoethylsulfanyl)-1,3-dithiol-2-yl]-1,3-thiazolidine-2-thione |
| Formula |
C12 H13 N3 S6 |
| Calculated formula |
C12 H13 N3 S6 |
| SMILES |
N#CCCSC1=C(SCCC#N)SC(S1)N1CCSC1=S |
| Title of publication |
3-[4,5-Bis(2-cyanoethylsulfanyl)-1,3-dithiol-2-yl]-1,3-thiazolidine-2-thione |
| Authors of publication |
Yang, Wei; Ren, Zhi-Gang; Dai, Jie; Ng, Seik Weng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
5 |
| Pages of publication |
o2598 - o2598 |
| a |
25.252 ± 0.005 Å |
| b |
8.2516 ± 0.0017 Å |
| c |
16.017 ± 0.003 Å |
| α |
90° |
| β |
96.34 ± 0.03° |
| γ |
90° |
| Cell volume |
3317 ± 1.1 Å3 |
| Cell temperature |
193 ± 2 K |
| Ambient diffraction temperature |
193 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0348 |
| Residual factor for significantly intense reflections |
0.0329 |
| Weighted residual factors for significantly intense reflections |
0.0795 |
| Weighted residual factors for all reflections included in the refinement |
0.0807 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.129 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2213320.html