Information card for entry 2213376
| Chemical name |
Methyl 6-methyl-2-oxo-4-(3,4,5-trimethoxyphenyl)-1,2,3,4-tetrahydropyrimidine- 5-carboxylate |
| Formula |
C16 H20 N2 O6 |
| Calculated formula |
C16 H20 N2 O6 |
| SMILES |
O(c1c(OC)c(OC)cc(c1)C1NC(=O)NC(=C1C(=O)OC)C)C |
| Title of publication |
Methyl 6-methyl-2-oxo-4-(3,4,5-trimethoxyphenyl)-1,2,3,4-tetrahydropyrimidine-5-carboxylate |
| Authors of publication |
Shang, Zhen-Hua; Shang, Qing |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
5 |
| Pages of publication |
o2280 - o2281 |
| a |
7.949 ± 0.003 Å |
| b |
10.176 ± 0.003 Å |
| c |
11.802 ± 0.004 Å |
| α |
111.237 ± 0.006° |
| β |
101.026 ± 0.006° |
| γ |
103.892 ± 0.006° |
| Cell volume |
821.9 ± 0.5 Å3 |
| Cell temperature |
294 ± 2 K |
| Ambient diffraction temperature |
294 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1323 |
| Residual factor for significantly intense reflections |
0.0516 |
| Weighted residual factors for significantly intense reflections |
0.1113 |
| Weighted residual factors for all reflections included in the refinement |
0.1476 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.996 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2213376.html