Information card for entry 2213410
| Common name |
2,8-dichloro Tröger's base |
| Chemical name |
2,8-Dichloro-6<i>H</i>,12<i>H</i>-5,11- methanodibenzo[<i>b</i>,<i>f</i>][1,5]diazocine |
| Formula |
C15 H12 Cl2 N2 |
| Calculated formula |
C15 H12 Cl2 N2 |
| SMILES |
Clc1ccc2N3Cc4c(N(Cc2c1)C3)ccc(Cl)c4 |
| Title of publication |
2,8-Dichloro-6<i>H</i>,12<i>H</i>-5,11-methanodibenzo[<i>b</i>,<i>f</i>][1,5]diazocine |
| Authors of publication |
Faroughi, Masoud; Try, Andrew C.; Turner, Peter |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
5 |
| Pages of publication |
o2695 - o2695 |
| a |
6.3017 ± 0.0018 Å |
| b |
10.203 ± 0.003 Å |
| c |
10.685 ± 0.003 Å |
| α |
83.059 ± 0.005° |
| β |
77.303 ± 0.004° |
| γ |
80.297 ± 0.005° |
| Cell volume |
658.1 ± 0.3 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0314 |
| Residual factor for significantly intense reflections |
0.0296 |
| Weighted residual factors for significantly intense reflections |
0.0758 |
| Weighted residual factors for all reflections included in the refinement |
0.0773 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.065 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2213410.html