Information card for entry 2213557
| Chemical name |
10-(2-Fluorophenyl)-9-(4-methoxyphenyl)-3,3,6,6-tetramethyl-3,4,6,7- tetrahydroacridine-1,8(2H,5H,9H,10H)-dione |
| Formula |
C30 H32 F N O3 |
| Calculated formula |
C30 H32 F N O3 |
| SMILES |
c1(c(cccc1)F)N1C2=C(C(=O)CC(C2)(C)C)C(c2ccc(cc2)OC)C2=C1CC(CC2=O)(C)C |
| Title of publication |
10-(2-Fluorophenyl)-9-(4-methoxyphenyl)-3,3,6,6-tetramethyl-3,4,6,7-tetrahydroacridine-1,8(2<i>H</i>,5<i>H</i>,9<i>H</i>,10<i>H</i>)-dione |
| Authors of publication |
Büyükgüngör, Orhan; Kaya, Muharrem; Odabaşoğlu, Mustafa; Yıldırır, Yılmaz |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
5 |
| Pages of publication |
o2275 - o2277 |
| a |
12.2403 ± 0.0006 Å |
| b |
10.4616 ± 0.0003 Å |
| c |
20.233 ± 0.0009 Å |
| α |
90° |
| β |
100.942 ± 0.004° |
| γ |
90° |
| Cell volume |
2543.8 ± 0.19 Å3 |
| Cell temperature |
296 K |
| Ambient diffraction temperature |
296 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0469 |
| Residual factor for significantly intense reflections |
0.0369 |
| Weighted residual factors for significantly intense reflections |
0.0971 |
| Weighted residual factors for all reflections included in the refinement |
0.1015 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.057 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2213557.html