Information card for entry 2213579
| Common name |
1,3,5-Tricyclopropyl-1,3,5-triazinane |
| Chemical name |
1,3,5-tricyclopropyl-1,3,5-triazinane |
| Formula |
C12 H21 N3 |
| Calculated formula |
C12 H21 N3 |
| SMILES |
N1(CN(CN(C1)C1CC1)C1CC1)C1CC1 |
| Title of publication |
1,3,5-Tricyclopropyl-1,3,5-triazinane |
| Authors of publication |
Poethig, Alexander; Ahrens, Sebastian; Strassner, Thomas |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
5 |
| Pages of publication |
o2398 - o2399 |
| a |
8.705 ± 0.001 Å |
| b |
16.231 ± 0.001 Å |
| c |
8.514 ± 0.002 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1203 ± 0.3 Å3 |
| Cell temperature |
198 ± 2 K |
| Ambient diffraction temperature |
198 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
33 |
| Hermann-Mauguin space group symbol |
P n a 21 |
| Hall space group symbol |
P 2c -2n |
| Residual factor for all reflections |
0.0402 |
| Residual factor for significantly intense reflections |
0.032 |
| Weighted residual factors for significantly intense reflections |
0.0739 |
| Weighted residual factors for all reflections included in the refinement |
0.0782 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.043 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2213579.html