Information card for entry 2213758
| Chemical name |
N^2^,N^4^,1-tribenzyl-2,5-dimethyl-3-oxopyrrolidine-2,4-dicarboxamide |
| Formula |
C29 H29 N3 O3 |
| Calculated formula |
C29 H29 N3 O3 |
| SMILES |
O=C(NCc1ccccc1)C1(N(Cc2ccccc2)C(=C(C1=O)C(=O)NCc1ccccc1)C)C |
| Title of publication |
<i>N</i>^2^,<i>N</i>^4^,1-Tribenzyl-2,5-dimethyl-3-oxopyrrolidine-2,4-dicarboxamide |
| Authors of publication |
Liang, Zu-Pei; Li, Jian; Yang, Hua |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
6 |
| Pages of publication |
o2817 - o2818 |
| a |
10.527 ± 0.002 Å |
| b |
11.611 ± 0.003 Å |
| c |
11.872 ± 0.003 Å |
| α |
105.096 ± 0.004° |
| β |
115.367 ± 0.004° |
| γ |
93.651 ± 0.004° |
| Cell volume |
1240.1 ± 0.5 Å3 |
| Cell temperature |
294 ± 2 K |
| Ambient diffraction temperature |
294 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.077 |
| Residual factor for significantly intense reflections |
0.044 |
| Weighted residual factors for significantly intense reflections |
0.1 |
| Weighted residual factors for all reflections included in the refinement |
0.119 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.03 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2213758.html
