Information card for entry 2213765
| Chemical name |
(4aS,6cS)-8-Hydroxy-9-isopropyl-4,4,6c-trimethyl-1,2,3,4,4a,5,6,6c- octahydrophenanthren-3-one |
| Formula |
C20 H28 O2 |
| Calculated formula |
C20 H28 O2 |
| SMILES |
C1CC(=O)C([C@H]2CCc3c([C@]12C)cc(c(c3)C(C)C)O)(C)C |
| Title of publication |
(4a<i>S</i>,6c<i>S</i>)-8-Hydroxy-9-isopropyl-4,4,6c-trimethyl-1,2,3,4,4a,5,6,6c-octahydrophenanthren-3-one |
| Authors of publication |
Zeroual, Abdellah; Mazoir, Noureddine; Maya, Celia M.; Berraho, Moha; Auhmani, Aziz; Benharref, Ahmed |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
6 |
| Pages of publication |
o2915 - o2915 |
| a |
7.5554 ± 0.0003 Å |
| b |
13.3987 ± 0.0006 Å |
| c |
16.7825 ± 0.0006 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1698.94 ± 0.12 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0422 |
| Residual factor for significantly intense reflections |
0.0375 |
| Weighted residual factors for significantly intense reflections |
0.1005 |
| Weighted residual factors for all reflections included in the refinement |
0.1054 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.069 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2213765.html