Information card for entry 2213954
| Chemical name |
5,5'-Dimethyl-4,4'-bis[2-(2-methyl-3-thienyl)cyclopentenyl]-2,2'-bithiophene |
| Formula |
C30 H30 S4 |
| Calculated formula |
C30 H30 S4 |
| SMILES |
Cc1sc(cc1C1=C(CCC1)c1ccsc1C)c1sc(c(c1)C1=C(CCC1)c1ccsc1C)C |
| Title of publication |
5,5'-Dimethyl-4,4'-bis[2-(2-methyl-3-thienyl)cyclopentenyl]-2,2'-bithiophene |
| Authors of publication |
Wissler, Jörg; Mulder, Alart; Tampé, Robert; Bolte, Michael |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
6 |
| Pages of publication |
o2813 - o2814 |
| a |
9.3105 ± 0.0007 Å |
| b |
14.0233 ± 0.0014 Å |
| c |
10.2143 ± 0.0008 Å |
| α |
90° |
| β |
96.901 ± 0.006° |
| γ |
90° |
| Cell volume |
1324 ± 0.2 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0408 |
| Residual factor for significantly intense reflections |
0.0371 |
| Weighted residual factors for significantly intense reflections |
0.0996 |
| Weighted residual factors for all reflections included in the refinement |
0.1019 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.062 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2213954.html