Information card for entry 2214244
| Chemical name |
(+)-(1R,2S,3S,4S)-2-Chloro-3-(phenylselanyl)cyclohexane-1,4-diol |
| Formula |
C12 H15 Cl O2 Se |
| Calculated formula |
C12 H15 Cl O2 Se |
| SMILES |
[Se]([C@@H]1[C@@H](Cl)[C@H](O)CC[C@@H]1O)c1ccccc1.[Se]([C@H]1[C@H](Cl)[C@@H](O)CC[C@H]1O)c1ccccc1 |
| Title of publication |
(+)-(1<i>R</i>,2<i>S</i>,3<i>S</i>,4<i>S</i>)-2-Chloro-3-(phenylselanyl)cyclohexane-1,4-diol |
| Authors of publication |
Robinson, Tony V.; Taylor, Dennis K.; Tiekink, Edward R. T. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
7 |
| Pages of publication |
o3350 - o3350 |
| a |
13.5529 ± 0.001 Å |
| b |
7.0627 ± 0.0005 Å |
| c |
12.9203 ± 0.0009 Å |
| α |
90° |
| β |
95.443 ± 0.001° |
| γ |
90° |
| Cell volume |
1231.16 ± 0.15 Å3 |
| Cell temperature |
223 ± 2 K |
| Ambient diffraction temperature |
223 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.033 |
| Residual factor for significantly intense reflections |
0.029 |
| Weighted residual factors for significantly intense reflections |
0.075 |
| Weighted residual factors for all reflections included in the refinement |
0.077 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.07 |
| Diffraction radiation wavelength |
0.71069 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2214244.html