Information card for entry 2214257
| Chemical name |
3-Chloro-1,1,1-trifluoro-3-(triphenylphosphoranylidene)propan-2-one |
| Formula |
C21 H15 Cl F3 O P |
| Calculated formula |
C21 H15 Cl F3 O P |
| SMILES |
ClC(=P(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)C(F)(F)F |
| Title of publication |
3-Chloro-1,1,1-trifluoro-3-(triphenylphosphoranylidene)propan-2-one |
| Authors of publication |
Wang, Zeng-Xue; Jiang, Hai-Zhen; Wan, Wen; Ge, Feng-Lian; Hao, Jian |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
7 |
| Pages of publication |
o3152 - o3152 |
| a |
10.6377 ± 0.0009 Å |
| b |
9.8603 ± 0.0009 Å |
| c |
18.3754 ± 0.0016 Å |
| α |
90° |
| β |
96.059 ± 0.001° |
| γ |
90° |
| Cell volume |
1916.6 ± 0.3 Å3 |
| Cell temperature |
273 ± 2 K |
| Ambient diffraction temperature |
273 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0395 |
| Residual factor for significantly intense reflections |
0.035 |
| Weighted residual factors for significantly intense reflections |
0.0864 |
| Weighted residual factors for all reflections included in the refinement |
0.09 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.03 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2214257.html