Information card for entry 2214451
| Chemical name |
Bis(2,2'-bipyridine-κ^2^N,N')(carbonato-κ^2^O,O')cobalt(III) trifluoromethanesulfonate |
| Formula |
C22 H16 Co F3 N4 O6 S |
| Calculated formula |
C22 H16 Co F3 N4 O6 S |
| SMILES |
[Co]123(OC(=O)O1)([n]1c(c4[n]2cccc4)cccc1)[n]1c(c2[n]3cccc2)cccc1.C(S(=O)(=O)[O-])(F)(F)F |
| Title of publication |
Bis(2,2'-bipyridine-κ^2^<i>N</i>,<i>N</i>')(carbonato-κ^2^<i>O</i>,<i>O</i>')cobalt(III) trifluoromethanesulfonate |
| Authors of publication |
Lv, Yang-Xiao; Ling, Yun; Li, Huan; Zhang, Lei |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
7 |
| Pages of publication |
m1906 - m1907 |
| a |
7.115 ± 0.003 Å |
| b |
11.054 ± 0.005 Å |
| c |
14.543 ± 0.006 Å |
| α |
95.668 ± 0.006° |
| β |
94.203 ± 0.005° |
| γ |
90.046 ± 0.006° |
| Cell volume |
1135.1 ± 0.8 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
7 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.09 |
| Residual factor for significantly intense reflections |
0.053 |
| Weighted residual factors for significantly intense reflections |
0.119 |
| Weighted residual factors for all reflections included in the refinement |
0.137 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.047 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2214451.html