Information card for entry 2214571
| Chemical name |
6,6-Dibenzyltetrazolo[1,5-<i>a</i>]pyrimidine-5,7(4<i>H</i>,6<i>H</i>)-dione |
| Formula |
C18 H15 N5 O2 |
| Calculated formula |
C18 H15 N5 O2 |
| SMILES |
O=C1Nc2nnnn2C(=O)C1(Cc1ccccc1)Cc1ccccc1 |
| Title of publication |
6,6-Dibenzyltetrazolo[1,5-<i>a</i>]pyrimidine-5,7(4<i>H</i>,6<i>H</i>)-dione |
| Authors of publication |
Baruah, Pranjal K.; Gonnade, Rajesh G.; Sanjayan, Gangadhar J. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
8 |
| Pages of publication |
o3550 - o3550 |
| a |
8.6247 ± 0.0013 Å |
| b |
16.777 ± 0.003 Å |
| c |
22.95 ± 0.004 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
3320.8 ± 1 Å3 |
| Cell temperature |
297 ± 2 K |
| Ambient diffraction temperature |
297 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.1005 |
| Residual factor for significantly intense reflections |
0.0515 |
| Weighted residual factors for significantly intense reflections |
0.1041 |
| Weighted residual factors for all reflections included in the refinement |
0.1217 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.008 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2214571.html