Information card for entry 2214581
| Chemical name |
4,5,6,7-Tetrachloro-3-(cyclohepta-1,3,6-trien-1-yl)-3-hydroxy-2- (2-hydroxyethyl)-2,3-dihydro-1<i>H</i>-isoindol-1-one |
| Formula |
C17 H13 Cl4 N O3 |
| Calculated formula |
C17 H13 Cl4 N O3 |
| SMILES |
OCCN1C(=O)c2c(C1(O)C1=CC=CCC=C1)c(Cl)c(c(c2Cl)Cl)Cl |
| Title of publication |
4,5,6,7-Tetrachloro-3-(cyclohepta-1,3,6-trien-1-yl)-3-hydroxy-2-(2-hydroxyethyl)-2,3-dihydro-1<i>H</i>-isoindol-1-one |
| Authors of publication |
Hoong-Kun Fun; Jeannie Bee-Jan Teh; Yong-Miao Shen; Jian-Hua Xu |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
8 |
| Pages of publication |
o3385 - o3385 |
| a |
5.7285 ± 0.0003 Å |
| b |
27.982 ± 0.0012 Å |
| c |
10.7301 ± 0.0005 Å |
| α |
90° |
| β |
105.816 ± 0.003° |
| γ |
90° |
| Cell volume |
1654.87 ± 0.14 Å3 |
| Cell temperature |
100 ± 0.1 K |
| Ambient diffraction temperature |
100 ± 0.1 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0594 |
| Residual factor for significantly intense reflections |
0.0467 |
| Weighted residual factors for significantly intense reflections |
0.1177 |
| Weighted residual factors for all reflections included in the refinement |
0.1299 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.119 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2214581.html