Information card for entry 2214958
| Chemical name |
Ethyl 5-(5,6-diphenyl-1,2,4-triazin-3-yl)-2,6-dimethylnicotinate |
| Formula |
C25 H22 N4 O2 |
| Calculated formula |
C25 H22 N4 O2 |
| SMILES |
c1(c(C)nc(c(c1)c1nnc(c(c2ccccc2)n1)c1ccccc1)C)C(=O)OCC |
| Title of publication |
Ethyl 5-(5,6-diphenyl-1,2,4-triazin-3-yl)-2,6-dimethylnicotinate |
| Authors of publication |
Lu, Dong-Liang; Zhang, Min; Song, Li-Ping; Huang, Pei-Gang; Xu, Li-Ying |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
9 |
| Pages of publication |
o3757 - o3757 |
| a |
8.952 ± 0.0013 Å |
| b |
27.347 ± 0.004 Å |
| c |
9.2555 ± 0.0013 Å |
| α |
90° |
| β |
107.626 ± 0.002° |
| γ |
90° |
| Cell volume |
2159.5 ± 0.5 Å3 |
| Cell temperature |
273 ± 2 K |
| Ambient diffraction temperature |
273 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0827 |
| Residual factor for significantly intense reflections |
0.0643 |
| Weighted residual factors for significantly intense reflections |
0.1894 |
| Weighted residual factors for all reflections included in the refinement |
0.2075 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.033 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2214958.html