Information card for entry 2215082
| Chemical name |
1,3,4,6,7,9-Hexabromo-2,3,4,5,6,7,8,9-octahydro-1H-trindene |
| Formula |
C15 H12 Br6 |
| Calculated formula |
C15 H12 Br6 |
| SMILES |
Br[C@H]1C[C@@H](Br)c2c1c1[C@@H](Br)C[C@@H](Br)c1c1[C@H](Br)C[C@H](Br)c21.Br[C@@H]1C[C@H](Br)c2c1c1[C@H](Br)C[C@H](Br)c1c1[C@@H](Br)C[C@@H](Br)c21 |
| Title of publication |
1,3,4,6,7,9-Hexabromo-2,3,4,5,6,7,8,9-octahydro-1<i>H</i>-trindene |
| Authors of publication |
Zhou, Sheng-Jun; Xie, Su-Yuan; Huang, Rong-Bin; Zheng, Lan-Sun |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
9 |
| Pages of publication |
o3819 - o3819 |
| a |
9.907 ± 0.003 Å |
| b |
9.712 ± 0.002 Å |
| c |
18.01 ± 0.005 Å |
| α |
90° |
| β |
95.436 ± 0.005° |
| γ |
90° |
| Cell volume |
1725.1 ± 0.8 Å3 |
| Cell temperature |
123 ± 2 K |
| Ambient diffraction temperature |
123 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0542 |
| Residual factor for significantly intense reflections |
0.0461 |
| Weighted residual factors for significantly intense reflections |
0.1091 |
| Weighted residual factors for all reflections included in the refinement |
0.1142 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.049 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2215082.html