Information card for entry 2215104
| Chemical name |
N,N'-Dibenzylethane-1,2-diammonium dinitrate |
| Formula |
C16 H22 N4 O6 |
| Calculated formula |
C16 H22 N4 O6 |
| SMILES |
c1(ccccc1)C[NH2+]CC[NH2+]Cc1ccccc1.N(=O)(=O)[O-].N(=O)(=O)[O-] |
| Title of publication |
<i>N</i>,<i>N</i>'-Dibenzylethane-1,2-diammonium dinitrate |
| Authors of publication |
Liu, Yu-Fen; Xia, Hai-Tao; Wang, Da-Qi; Yang, Shu-Ping; Meng, Yong-Lu |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
9 |
| Pages of publication |
o3836 - o3836 |
| a |
5.7889 ± 0.0015 Å |
| b |
5.5654 ± 0.0014 Å |
| c |
29.858 ± 0.003 Å |
| α |
90° |
| β |
91.638 ± 0.003° |
| γ |
90° |
| Cell volume |
961.6 ± 0.4 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.115 |
| Residual factor for significantly intense reflections |
0.0719 |
| Weighted residual factors for significantly intense reflections |
0.1903 |
| Weighted residual factors for all reflections included in the refinement |
0.2153 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.018 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2215104.html