Information card for entry 2215256
| Chemical name |
7,8-dichloro-1,2,3,4-tetrahydrophenazine |
| Formula |
C12 H10 Cl2 N2 |
| Calculated formula |
C12 H10 Cl2 N2 |
| SMILES |
Clc1c(Cl)cc2nc3c(nc2c1)CCCC3 |
| Title of publication |
7,8-Dichloro-1,2,3,4-tetrahydrophenazine |
| Authors of publication |
Cesar H. Zambrano; Robert D. Pike; Ricky Joseph Paul Gibson; Barger, Brittany D.; Eric Efrain Dueno |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
9 |
| Pages of publication |
o3841 - o3841 |
| a |
6.3442 ± 0.0003 Å |
| b |
7.3885 ± 0.0003 Å |
| c |
11.7831 ± 0.0005 Å |
| α |
85.72 ± 0.002° |
| β |
82.122 ± 0.002° |
| γ |
83.572 ± 0.002° |
| Cell volume |
542.68 ± 0.04 Å3 |
| Cell temperature |
200 ± 2 K |
| Ambient diffraction temperature |
200 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0323 |
| Residual factor for significantly intense reflections |
0.0318 |
| Weighted residual factors for significantly intense reflections |
0.0885 |
| Weighted residual factors for all reflections included in the refinement |
0.0893 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.05 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2215256.html
