Information card for entry 2215587
| Chemical name |
4,5-Dimethyl-1,2-bis(pyridine-3-carboxamido)benzene |
| Formula |
C20 H18 N4 O2 |
| Calculated formula |
C20 H18 N4 O2 |
| SMILES |
n1cc(ccc1)C(=O)Nc1cc(c(cc1NC(=O)c1cccnc1)C)C |
| Title of publication |
4,5-Dimethyl-1,2-bis(pyridine-3-carboxamido)benzene |
| Authors of publication |
Kwak, Han; Park, Chi-Ho; Kim, Pan-Gi; Kim, Cheal; Kim, Youngmee |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
10 |
| Pages of publication |
o4104 - o4105 |
| a |
8.086 ± 0.002 Å |
| b |
17.96 ± 0.005 Å |
| c |
12.135 ± 0.003 Å |
| α |
90° |
| β |
101.467 ± 0.005° |
| γ |
90° |
| Cell volume |
1727.1 ± 0.8 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0689 |
| Residual factor for significantly intense reflections |
0.0429 |
| Weighted residual factors for significantly intense reflections |
0.101 |
| Weighted residual factors for all reflections included in the refinement |
0.1108 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.042 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2215587.html