Information card for entry 2215669
| Chemical name |
6-Chloro-N4-(2,2,6,6-tetramethylpiperidin-4-yl)-N2-(2,4,4- trimethylpentan-2-yl)-1,3,5-triazine-2,4-diamine |
| Formula |
C20 H37 Cl N6 |
| Calculated formula |
C20 H37 Cl N6 |
| SMILES |
Clc1nc(nc(n1)NC1CC(NC(C1)(C)C)(C)C)NC(CC(C)(C)C)(C)C |
| Title of publication |
6-Chloro-<i>N</i>^4^-(2,2,6,6-tetramethylpiperidin-4-yl)-<i>N</i>^2^-(2,4,4-trimethylpentan-2-yl)-1,3,5-triazine-2,4-diamine |
| Authors of publication |
Dong, Jun-Ying; Huang, Peng-Mian |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
10 |
| Pages of publication |
o4113 - o4113 |
| a |
7.9906 ± 0.0007 Å |
| b |
20.5197 ± 0.0016 Å |
| c |
13.6338 ± 0.001 Å |
| α |
90° |
| β |
97.273 ± 0.003° |
| γ |
90° |
| Cell volume |
2217.5 ± 0.3 Å3 |
| Cell temperature |
113 ± 2 K |
| Ambient diffraction temperature |
113 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0482 |
| Residual factor for significantly intense reflections |
0.0443 |
| Weighted residual factors for significantly intense reflections |
0.0996 |
| Weighted residual factors for all reflections included in the refinement |
0.1022 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.092 |
| Diffraction radiation wavelength |
0.7107 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2215669.html