Information card for entry 2215714
| Chemical name |
{N-[2-(2,6-Dimethylphenylamino)benzylidene]-2,6-dimethylaniline- κ^2^<i>N</i>,<i>N</i>'}dimethylaluminium(III) |
| Formula |
C25 H29 Al N2 |
| Calculated formula |
C25 H29 Al N2 |
| SMILES |
[Al]1(N(c2ccccc2C=[N]1c1c(cccc1C)C)c1c(cccc1C)C)(C)C |
| Title of publication |
{<i>N</i>-[2-(2,6-Dimethylphenylamino)benzylidene]-2,6-dimethylaniline-κ^2^<i>N</i>,<i>N</i>'}dimethylaluminium(III) |
| Authors of publication |
Liu, Xiao-Ming; Gao, Wei; Li, Bao; Ni, Jian-Guo; Mu, Ying |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
10 |
| Pages of publication |
m2549 |
| a |
9.0483 ± 0.0018 Å |
| b |
11.045 ± 0.002 Å |
| c |
24.192 ± 0.005 Å |
| α |
90° |
| β |
111.64 ± 0.03° |
| γ |
90° |
| Cell volume |
2247.3 ± 0.9 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.099 |
| Residual factor for significantly intense reflections |
0.0469 |
| Weighted residual factors for significantly intense reflections |
0.0953 |
| Weighted residual factors for all reflections included in the refinement |
0.1055 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.962 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2215714.html