Information card for entry 2215814
| Chemical name |
(SP-4-2)-(4,4'-Di-<i>tert</i>-butyl-2,2'-bipyridine- κ<i>N</i>,κ<i>N</i>')diiodidopalladium(II) |
| Formula |
C18 H24 I2 N2 Pd |
| Calculated formula |
C18 H24 I2 N2 Pd |
| SMILES |
[Pd]1([n]2c(c3[n]1ccc(c3)C(C)(C)C)cc(cc2)C(C)(C)C)(I)I |
| Title of publication |
(<i>SP</i>-4-2)-(4,4'-Di-<i>tert</i>-butyl-2,2'-bipyridine-κ^2^<i>N</i>,<i>N</i>')diiodidopalladium(II) |
| Authors of publication |
Jones, Peter G.; Fernández-Rodríguez, María J.; Martínez-Martínez, Antonio J. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
11 |
| Pages of publication |
m2758 - m2758 |
| a |
7.7201 ± 0.0006 Å |
| b |
19.4695 ± 0.0016 Å |
| c |
13.412 ± 0.0011 Å |
| α |
90° |
| β |
100.29 ± 0.004° |
| γ |
90° |
| Cell volume |
1983.5 ± 0.3 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.053 |
| Residual factor for significantly intense reflections |
0.0434 |
| Weighted residual factors for significantly intense reflections |
0.1152 |
| Weighted residual factors for all reflections included in the refinement |
0.1211 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.068 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2215814.html