Information card for entry 2215955
| Chemical name |
Methyl 1-methyl-8-nitro-5-oxo-1,2,3,5-tetrahydroimidazo[1,2-a]pyridine-7-carboxylate |
| Formula |
C10 H11 N3 O5 |
| Calculated formula |
C10 H11 N3 O5 |
| SMILES |
O=N(=O)c1c2N(C)CCn2c(=O)cc1C(=O)OC |
| Title of publication |
Methyl 1-methyl-8-nitro-5-oxo-1,2,3,5-tetrahydroimidazo[1,2-<i>a</i>]pyridine-7-carboxylate |
| Authors of publication |
Wang, Li; Li, Hui |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
11 |
| Pages of publication |
o4427 - o4427 |
| a |
9.848 ± 0.005 Å |
| b |
10.738 ± 0.005 Å |
| c |
11.318 ± 0.006 Å |
| α |
90° |
| β |
108.165 ± 0.008° |
| γ |
90° |
| Cell volume |
1137.2 ± 1 Å3 |
| Cell temperature |
294 ± 2 K |
| Ambient diffraction temperature |
294 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0667 |
| Residual factor for significantly intense reflections |
0.04 |
| Weighted residual factors for significantly intense reflections |
0.105 |
| Weighted residual factors for all reflections included in the refinement |
0.1257 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.04 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2215955.html