Information card for entry 2216023
| Chemical name |
3-Butyl-2-(piperidin-1-yl)-5,6,7,8-tetrahydrobenzothieno[2,3-d]pyrimidin- 4(3H)-one |
| Formula |
C19 H27 N3 O S |
| Calculated formula |
C19 H27 N3 O S |
| SMILES |
s1c2nc(n(CCCC)c(=O)c2c2c1CCCC2)N1CCCCC1 |
| Title of publication |
3-Butyl-2-(piperidin-1-yl)-5,6,7,8-tetrahydrobenzothieno[2,3-<i>d</i>]pyrimidin-4(3<i>H</i>)-one |
| Authors of publication |
Wang, Hong-Mei; Zeng, Xiao-Hua; Zheng, Ai-Hua; Tian, Jia-Hua; He, Ting-Yun |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
11 |
| Pages of publication |
o4365 - o4365 |
| a |
9.8979 ± 0.0008 Å |
| b |
10.3679 ± 0.0009 Å |
| c |
10.9645 ± 0.0009 Å |
| α |
113.537 ± 0.001° |
| β |
107.679 ± 0.001° |
| γ |
100.167 ± 0.001° |
| Cell volume |
923.97 ± 0.13 Å3 |
| Cell temperature |
292 ± 2 K |
| Ambient diffraction temperature |
292 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0909 |
| Residual factor for significantly intense reflections |
0.0588 |
| Weighted residual factors for significantly intense reflections |
0.1499 |
| Weighted residual factors for all reflections included in the refinement |
0.1838 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.026 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2216023.html