Information card for entry 2216101
| Chemical name |
(2,2'-Bipyridine-κ^2^N,N')dichlorido(dimethyl sulfoxide-κO)zinc(II) |
| Formula |
C12 H14 Cl2 N2 O S Zn |
| Calculated formula |
C12 H14 Cl2 N2 O S Zn |
| SMILES |
c1cccc2c3cccc[n]3[Zn]([n]12)([O]=S(C)C)(Cl)Cl |
| Title of publication |
(2,2'-Bipyridine-κ^2^<i>N</i>,<i>N</i>')dichlorido(dimethyl sulfoxide-κ<i>O</i>)zinc(II) |
| Authors of publication |
Marjani, Katayoun; Mousavi, Mohsen; Khavasi, Hamid Reza; Ansari, Maryam; Qumi, Hamid Reza |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
11 |
| Pages of publication |
m2645 - m2645 |
| a |
7.9553 ± 0.0017 Å |
| b |
9.5504 ± 0.0019 Å |
| c |
10.003 ± 0.002 Å |
| α |
84.042 ± 0.016° |
| β |
86.787 ± 0.017° |
| γ |
83.798 ± 0.017° |
| Cell volume |
750.7 ± 0.3 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
7 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0311 |
| Residual factor for significantly intense reflections |
0.0301 |
| Weighted residual factors for significantly intense reflections |
0.0788 |
| Weighted residual factors for all reflections included in the refinement |
0.0795 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.074 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2216101.html