Information card for entry 2216558
| Chemical name |
(R,S)-Diethyl {[5-(2,4-dichlorophenyl)-1,3,4-thiadiazol-2-ylamino](phenyl)methyl}phosphonate |
| Formula |
C19 H20 Cl2 N3 O3 P S |
| Calculated formula |
C19 H20 Cl2 N3 O3 P S |
| SMILES |
Clc1c(c2sc(NC(P(=O)(OCC)OCC)c3ccccc3)nn2)ccc(Cl)c1 |
| Title of publication |
(<i>R</i>,<i>S</i>)-Diethyl {[5-(2,4-dichlorophenyl)-1,3,4-thiadiazol-2-ylamino](phenyl)methyl}phosphonate |
| Authors of publication |
Yin, Li-He; Wan, Rong; Wu, Wen-Yuan; Wang, Bin; Wang, Jin-Tang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
12 |
| Pages of publication |
o4648 - o4648 |
| a |
8.487 ± 0.0017 Å |
| b |
16.53 ± 0.003 Å |
| c |
15.703 ± 0.003 Å |
| α |
90° |
| β |
94.47 ± 0.03° |
| γ |
90° |
| Cell volume |
2196.3 ± 0.7 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
7 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.1114 |
| Residual factor for significantly intense reflections |
0.0847 |
| Weighted residual factors for significantly intense reflections |
0.1292 |
| Weighted residual factors for all reflections included in the refinement |
0.1544 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.168 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2216558.html